C19H18N4O4 — CID 22060485
ethyl 2,4-bis(3-hydroxyanilino)pyrimidine-5-carboxylate (PubChem CID 22060485) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is ethyl 2,4-bis(3-hydroxyanilino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2,4-bis(3-hydroxyanilino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 22060485 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | ethyl 2,4-bis(3-hydroxyanilino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2cccc(O)c2)nc1Nc1cccc(O)c1 |
| InChI | InChI=1S/C19H18N4O4/c1-2-27-18(26)16-11-20-19(22-13-6-4-8-15(25)10-13)23-17(16)21-12-5-3-7-14(24)9-12/h3-11,24-25H,2H2,1H3,(H2,20,21,22,23) |
| InChIKey | KUPNHMXSMULDNB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |