C21H18N8O2 — CID 22060714
ethyl 2,4-bis(1H-indazol-7-ylamino)pyrimidine-5-carboxylate (PubChem CID 22060714) has the molecular formula C21H18N8O2 and a molecular weight of 414.43 g/mol. Its IUPAC name is ethyl 2,4-bis(1H-indazol-7-ylamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2,4-bis(1H-indazol-7-ylamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 22060714 |
| Molecular Formula | C21H18N8O2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | ethyl 2,4-bis(1H-indazol-7-ylamino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2cccc3cn[nH]c23)nc1Nc1cccc2cn[nH]c12 |
| InChI | InChI=1S/C21H18N8O2/c1-2-31-20(30)14-11-22-21(26-16-8-4-6-13-10-24-29-18(13)16)27-19(14)25-15-7-3-5-12-9-23-28-17(12)15/h3-11H,2H2,1H3,(H,23,28)(H,24,29)(H2,22,25,26,27) |
| InChIKey | SSBMGLVAFSYTML-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |