C20H20N4O4 — CID 22060720
ethyl 2-(3-hydroxyanilino)-4-(phenylmethoxyamino)pyrimidine-5-carboxylate (PubChem CID 22060720) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is ethyl 2-(3-hydroxyanilino)-4-(phenylmethoxyamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(3-hydroxyanilino)-4-(phenylmethoxyamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 22060720 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | ethyl 2-(3-hydroxyanilino)-4-(phenylmethoxyamino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2cccc(O)c2)nc1NOCc1ccccc1 |
| InChI | InChI=1S/C20H20N4O4/c1-2-27-19(26)17-12-21-20(22-15-9-6-10-16(25)11-15)23-18(17)24-28-13-14-7-4-3-5-8-14/h3-12,25H,2,13H2,1H3,(H2,21,22,23,24) |
| InChIKey | YDSJDSWGOVDORY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|