C21H30N6O4S — CID 175430749
ethyl 4-[3-(carbamothioylamino)propylamino]-2-(3-methylanilino)pyrimidine-5-carboxylate;propanoic acid (PubChem CID 175430749) has the molecular formula C21H30N6O4S and a molecular weight of 462.58 g/mol. Its IUPAC name is ethyl 4-[3-(carbamothioylamino)propylamino]-2-(3-methylanilino)pyrimidine-5-carboxylate;propanoic acid.
| Compound Name | ethyl 4-[3-(carbamothioylamino)propylamino]-2-(3-methylanilino)pyrimidine-5-carboxylate;propanoic acid |
|---|---|
| PubChem CID | 175430749 |
| Molecular Formula | C21H30N6O4S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | ethyl 4-[3-(carbamothioylamino)propylamino]-2-(3-methylanilino)pyrimidine-5-carboxylate;propanoic acid |
| SMILES | CCC(=O)O.CCOC(=O)c1cnc(Nc2cccc(C)c2)nc1NCCCNC(N)=S |
| InChI | InChI=1S/C18H24N6O2S.C3H6O2/c1-3-26-16(25)14-11-22-18(23-13-7-4-6-12(2)10-13)24-15(14)20-8-5-9-21-17(19)27;1-2-3(4)5/h4,6-7,10-11H,3,5,8-9H2,1-2H3,(H3,19,21,27)(H2,20,22,23,24);2H2,1H3,(H,4,5) |
| InChIKey | DARMRWDRMUMURO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 151.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|