C17H19N3O4S — CID 9150222
ethyl 2-methylsulfanyl-4-(3-propanoyloxyanilino)pyrimidine-5-carboxylate (PubChem CID 9150222) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is ethyl 2-methylsulfanyl-4-(3-propanoyloxyanilino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-methylsulfanyl-4-(3-propanoyloxyanilino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 9150222 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | ethyl 2-methylsulfanyl-4-(3-propanoyloxyanilino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC)nc1Nc1cccc(OC(=O)CC)c1 |
| InChI | InChI=1S/C17H19N3O4S/c1-4-14(21)24-12-8-6-7-11(9-12)19-15-13(16(22)23-5-2)10-18-17(20-15)25-3/h6-10H,4-5H2,1-3H3,(H,18,19,20) |
| InChIKey | VCDIVCJOBLYCNX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|