C19H17N3O4S2 — CID 9150273
ethyl 2-methylsulfanyl-4-[3-(thiophene-2-carbonyloxy)anilino]pyrimidine-5-carboxylate (PubChem CID 9150273) has the molecular formula C19H17N3O4S2 and a molecular weight of 415.50 g/mol. Its IUPAC name is ethyl 2-methylsulfanyl-4-[3-(thiophene-2-carbonyloxy)anilino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-methylsulfanyl-4-[3-(thiophene-2-carbonyloxy)anilino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 9150273 |
| Molecular Formula | C19H17N3O4S2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | ethyl 2-methylsulfanyl-4-[3-(thiophene-2-carbonyloxy)anilino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC)nc1Nc1cccc(OC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H17N3O4S2/c1-3-25-17(23)14-11-20-19(27-2)22-16(14)21-12-6-4-7-13(10-12)26-18(24)15-8-5-9-28-15/h4-11H,3H2,1-2H3,(H,20,21,22) |
| InChIKey | XXOVJTJEACMYNW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|