C19H17N3O2S — CID 123150914
[3-[[5,6-di(ethylidene)pyrimidin-4-yl]amino]phenyl] thiophene-2-carboxylate (PubChem CID 123150914) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is [3-[[5,6-di(ethylidene)pyrimidin-4-yl]amino]phenyl] thiophene-2-carboxylate.
| Compound Name | [3-[[5,6-di(ethylidene)pyrimidin-4-yl]amino]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 123150914 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | [3-[[5,6-di(ethylidene)pyrimidin-4-yl]amino]phenyl] thiophene-2-carboxylate |
| SMILES | CC=c1ncnc(Nc2cccc(OC(=O)c3cccs3)c2)c1=CC |
| InChI | InChI=1S/C19H17N3O2S/c1-3-15-16(4-2)20-12-21-18(15)22-13-7-5-8-14(11-13)24-19(23)17-9-6-10-25-17/h3-12H,1-2H3,(H,20,21,22) |
| InChIKey | PMTFCYODHARQRW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|