C23H16N2O5S — CID 1316119
[3-[[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] thiophene-2-carboxylate (PubChem CID 1316119) has the molecular formula C23H16N2O5S and a molecular weight of 432.46 g/mol. Its IUPAC name is [3-[[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [3-[[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1316119 |
| Molecular Formula | C23H16N2O5S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | [3-[[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] thiophene-2-carboxylate |
| SMILES | CC(=O)Nc1ccc(C2=NC(=Cc3cccc(OC(=O)c4cccs4)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C23H16N2O5S/c1-14(26)24-17-9-7-16(8-10-17)21-25-19(22(27)30-21)13-15-4-2-5-18(12-15)29-23(28)20-6-3-11-31-20/h2-13H,1H3,(H,24,26) |
| InChIKey | CVEVQJHJUVLDLN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|