C18H13FN2O3 — CID 24508818
N-[4-[(4Z)-4-[(3-fluorophenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide (PubChem CID 24508818) has the molecular formula C18H13FN2O3 and a molecular weight of 324.31 g/mol. Its IUPAC name is N-[4-[(4Z)-4-[(3-fluorophenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[(4Z)-4-[(3-fluorophenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 24508818 |
| Molecular Formula | C18H13FN2O3 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-[4-[(4Z)-4-[(3-fluorophenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=N/C(=C\c3cccc(F)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C18H13FN2O3/c1-11(22)20-15-7-5-13(6-8-15)17-21-16(18(23)24-17)10-12-3-2-4-14(19)9-12/h2-10H,1H3,(H,20,22)/b16-10- |
| InChIKey | QBYCRWOGOMLMFL-YBEGLDIGSA-N |
| XLogP | 3.13 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|