C20H18N2O5 — CID 8892406
N-[4-[(Z)-[2-(3,4-dimethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl]acetamide (PubChem CID 8892406) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is N-[4-[(Z)-[2-(3,4-dimethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl]acetamide.
| Compound Name | N-[4-[(Z)-[2-(3,4-dimethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 8892406 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[4-[(Z)-[2-(3,4-dimethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl]acetamide |
| SMILES | COc1ccc(C2=N/C(=C\c3ccc(NC(C)=O)cc3)C(=O)O2)cc1OC |
| InChI | InChI=1S/C20H18N2O5/c1-12(23)21-15-7-4-13(5-8-15)10-16-20(24)27-19(22-16)14-6-9-17(25-2)18(11-14)26-3/h4-11H,1-3H3,(H,21,23)/b16-10- |
| InChIKey | YZCBKBNUKZSEQS-YBEGLDIGSA-N |
| XLogP | 3.01 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|