C19H16N2O4 — CID 8892407
N-[4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl]acetamide (PubChem CID 8892407) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-[4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl]acetamide.
| Compound Name | N-[4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 8892407 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl]acetamide |
| SMILES | COc1ccc(C2=N/C(=C\c3ccc(NC(C)=O)cc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C19H16N2O4/c1-12(22)20-15-7-3-13(4-8-15)11-17-19(23)25-18(21-17)14-5-9-16(24-2)10-6-14/h3-11H,1-2H3,(H,20,22)/b17-11- |
| InChIKey | DECROYCGHBXGAO-BOPFTXTBSA-N |
| XLogP | 3.00 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|