C24H18N2O7S — CID 72831194
[4-[[2-[4-[(2-hydroxyacetyl)amino]phenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 72831194) has the molecular formula C24H18N2O7S and a molecular weight of 478.48 g/mol. Its IUPAC name is [4-[[2-[4-[(2-hydroxyacetyl)amino]phenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[[2-[4-[(2-hydroxyacetyl)amino]phenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 72831194 |
| Molecular Formula | C24H18N2O7S |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | [4-[[2-[4-[(2-hydroxyacetyl)amino]phenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(C=C2N=C(c3ccc(NC(=O)CO)cc3)OC2=O)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C24H18N2O7S/c1-31-19-12-14(4-9-18(19)32-24(30)20-3-2-10-34-20)11-17-23(29)33-22(26-17)15-5-7-16(8-6-15)25-21(28)13-27/h2-12,27H,13H2,1H3,(H,25,28) |
| InChIKey | QMHTXXWMAOCISI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|