C17H15N3O4S2 — CID 92703241
[3-[(2S)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]phenyl] thiophene-2-carboxylate (PubChem CID 92703241) has the molecular formula C17H15N3O4S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is [3-[(2S)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]phenyl] thiophene-2-carboxylate.
| Compound Name | [3-[(2S)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 92703241 |
| Molecular Formula | C17H15N3O4S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | [3-[(2S)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]phenyl] thiophene-2-carboxylate |
| SMILES | CC(=O)NC1=NN(C(C)=O)[C@H](c2cccc(OC(=O)c3cccs3)c2)S1 |
| InChI | InChI=1S/C17H15N3O4S2/c1-10(21)18-17-19-20(11(2)22)15(26-17)12-5-3-6-13(9-12)24-16(23)14-7-4-8-25-14/h3-9,15H,1-2H3,(H,18,19,21)/t15-/m0/s1 |
| InChIKey | LPJSDRXMFKHHHA-HNNXBMFYSA-N |
| XLogP | 2.97 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|