C19H19N3O6S — CID 92702959
[4-[(2R)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-ethoxyphenyl] furan-2-carboxylate (PubChem CID 92702959) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is [4-[(2R)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-ethoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[(2R)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-ethoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 92702959 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | [4-[(2R)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-ethoxyphenyl] furan-2-carboxylate |
| SMILES | CCOc1cc([C@H]2SC(NC(C)=O)=NN2C(C)=O)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C19H19N3O6S/c1-4-26-16-10-13(7-8-14(16)28-18(25)15-6-5-9-27-15)17-22(12(3)24)21-19(29-17)20-11(2)23/h5-10,17H,4H2,1-3H3,(H,20,21,23)/t17-/m1/s1 |
| InChIKey | IMQPUDZXXCMYNE-QGZVFWFLSA-N |
| XLogP | 2.90 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|