C25H29N3O5S — CID 92702952
[4-[(2S)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-ethoxyphenyl] 4-tert-butylbenzoate (PubChem CID 92702952) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is [4-[(2S)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-ethoxyphenyl] 4-tert-butylbenzoate.
| Compound Name | [4-[(2S)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-ethoxyphenyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 92702952 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | [4-[(2S)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-ethoxyphenyl] 4-tert-butylbenzoate |
| SMILES | CCOc1cc([C@@H]2SC(NC(C)=O)=NN2C(C)=O)ccc1OC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H29N3O5S/c1-7-32-21-14-18(22-28(16(3)30)27-24(34-22)26-15(2)29)10-13-20(21)33-23(31)17-8-11-19(12-9-17)25(4,5)6/h8-14,22H,7H2,1-6H3,(H,26,27,29)/t22-/m0/s1 |
| InChIKey | ZIKWTBNNAKNZKG-QFIPXVFZSA-N |
| XLogP | 4.60 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|