C19H18ClN3O5S2 — CID 92703006
[4-[(2R)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-chlorophenyl] 4-methylbenzenesulfonate (PubChem CID 92703006) has the molecular formula C19H18ClN3O5S2 and a molecular weight of 467.96 g/mol. Its IUPAC name is [4-[(2R)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-chlorophenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(2R)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-chlorophenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 92703006 |
| Molecular Formula | C19H18ClN3O5S2 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | [4-[(2R)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-chlorophenyl] 4-methylbenzenesulfonate |
| SMILES | CC(=O)NC1=NN(C(C)=O)[C@@H](c2ccc(OS(=O)(=O)c3ccc(C)cc3)c(Cl)c2)S1 |
| InChI | InChI=1S/C19H18ClN3O5S2/c1-11-4-7-15(8-5-11)30(26,27)28-17-9-6-14(10-16(17)20)18-23(13(3)25)22-19(29-18)21-12(2)24/h4-10,18H,1-3H3,(H,21,22,24)/t18-/m1/s1 |
| InChIKey | MDCJRQXJJITAHF-GOSISDBHSA-N |
| XLogP | 3.42 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|