C20H19N3O4S — CID 23613351
[4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)phenyl] 3-methylbenzoate (PubChem CID 23613351) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)phenyl] 3-methylbenzoate.
| Compound Name | [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 23613351 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [4-(5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl)phenyl] 3-methylbenzoate |
| SMILES | CC(=O)NC1=NN(C(C)=O)C(c2ccc(OC(=O)c3cccc(C)c3)cc2)S1 |
| InChI | InChI=1S/C20H19N3O4S/c1-12-5-4-6-16(11-12)19(26)27-17-9-7-15(8-10-17)18-23(14(3)25)22-20(28-18)21-13(2)24/h4-11,18H,1-3H3,(H,21,22,24) |
| InChIKey | AZCDRPTXMXSQFX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|