C21H22BrN3O4S — CID 23613389
N-[3-acetyl-2-[3-bromo-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide (PubChem CID 23613389) has the molecular formula C21H22BrN3O4S and a molecular weight of 492.40 g/mol. Its IUPAC name is N-[3-acetyl-2-[3-bromo-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide.
| Compound Name | N-[3-acetyl-2-[3-bromo-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 23613389 |
| Molecular Formula | C21H22BrN3O4S |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | N-[3-acetyl-2-[3-bromo-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide |
| SMILES | CC(=O)NC1=NN(C(C)=O)C(c2ccc(OCCOc3ccc(C)cc3)c(Br)c2)S1 |
| InChI | InChI=1S/C21H22BrN3O4S/c1-13-4-7-17(8-5-13)28-10-11-29-19-9-6-16(12-18(19)22)20-25(15(3)27)24-21(30-20)23-14(2)26/h4-9,12,20H,10-11H2,1-3H3,(H,23,24,26) |
| InChIKey | LAMLNJXKPDMOBD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|