C24H29N3O4S — CID 92702813
N-[(2S)-3-acetyl-2-[4-[2-(4-tert-butylphenoxy)ethoxy]phenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide (PubChem CID 92702813) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is N-[(2S)-3-acetyl-2-[4-[2-(4-tert-butylphenoxy)ethoxy]phenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide.
| Compound Name | N-[(2S)-3-acetyl-2-[4-[2-(4-tert-butylphenoxy)ethoxy]phenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 92702813 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | N-[(2S)-3-acetyl-2-[4-[2-(4-tert-butylphenoxy)ethoxy]phenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide |
| SMILES | CC(=O)NC1=NN(C(C)=O)[C@H](c2ccc(OCCOc3ccc(C(C)(C)C)cc3)cc2)S1 |
| InChI | InChI=1S/C24H29N3O4S/c1-16(28)25-23-26-27(17(2)29)22(32-23)18-6-10-20(11-7-18)30-14-15-31-21-12-8-19(9-13-21)24(3,4)5/h6-13,22H,14-15H2,1-5H3,(H,25,26,28)/t22-/m0/s1 |
| InChIKey | HEFJOVOGPKKSLL-QFIPXVFZSA-N |
| XLogP | 4.44 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|