C24H28ClN3O4S — CID 23613424
N-[3-acetyl-2-[2-[2-(4-tert-butylphenoxy)ethoxy]-5-chlorophenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide (PubChem CID 23613424) has the molecular formula C24H28ClN3O4S and a molecular weight of 490.03 g/mol. Its IUPAC name is N-[3-acetyl-2-[2-[2-(4-tert-butylphenoxy)ethoxy]-5-chlorophenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide.
| Compound Name | N-[3-acetyl-2-[2-[2-(4-tert-butylphenoxy)ethoxy]-5-chlorophenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 23613424 |
| Molecular Formula | C24H28ClN3O4S |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | N-[3-acetyl-2-[2-[2-(4-tert-butylphenoxy)ethoxy]-5-chlorophenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide |
| SMILES | CC(=O)NC1=NN(C(C)=O)C(c2cc(Cl)ccc2OCCOc2ccc(C(C)(C)C)cc2)S1 |
| InChI | InChI=1S/C24H28ClN3O4S/c1-15(29)26-23-27-28(16(2)30)22(33-23)20-14-18(25)8-11-21(20)32-13-12-31-19-9-6-17(7-10-19)24(3,4)5/h6-11,14,22H,12-13H2,1-5H3,(H,26,27,29) |
| InChIKey | JGNGWEDZAPHFKL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|