C20H17ClFN3O5S — CID 92702963
[4-[(2R)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-chloro-6-methoxyphenyl] 4-fluorobenzoate (PubChem CID 92702963) has the molecular formula C20H17ClFN3O5S and a molecular weight of 465.89 g/mol. Its IUPAC name is [4-[(2R)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-chloro-6-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [4-[(2R)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-chloro-6-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 92702963 |
| Molecular Formula | C20H17ClFN3O5S |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | [4-[(2R)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]-2-chloro-6-methoxyphenyl] 4-fluorobenzoate |
| SMILES | COc1cc([C@H]2SC(NC(C)=O)=NN2C(C)=O)cc(Cl)c1OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17ClFN3O5S/c1-10(26)23-20-24-25(11(2)27)18(31-20)13-8-15(21)17(16(9-13)29-3)30-19(28)12-4-6-14(22)7-5-12/h4-9,18H,1-3H3,(H,23,24,26)/t18-/m1/s1 |
| InChIKey | RFEDHRAYJVYMAE-GOSISDBHSA-N |
| XLogP | 3.71 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|