C21H22ClN3O5S — CID 92702792
N-[(2S)-3-acetyl-2-[3-chloro-5-methoxy-4-(2-phenoxyethoxy)phenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide (PubChem CID 92702792) has the molecular formula C21H22ClN3O5S and a molecular weight of 463.94 g/mol. Its IUPAC name is N-[(2S)-3-acetyl-2-[3-chloro-5-methoxy-4-(2-phenoxyethoxy)phenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide.
| Compound Name | N-[(2S)-3-acetyl-2-[3-chloro-5-methoxy-4-(2-phenoxyethoxy)phenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 92702792 |
| Molecular Formula | C21H22ClN3O5S |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | N-[(2S)-3-acetyl-2-[3-chloro-5-methoxy-4-(2-phenoxyethoxy)phenyl]-2H-1,3,4-thiadiazol-5-yl]acetamide |
| SMILES | COc1cc([C@@H]2SC(NC(C)=O)=NN2C(C)=O)cc(Cl)c1OCCOc1ccccc1 |
| InChI | InChI=1S/C21H22ClN3O5S/c1-13(26)23-21-24-25(14(2)27)20(31-21)15-11-17(22)19(18(12-15)28-3)30-10-9-29-16-7-5-4-6-8-16/h4-8,11-12,20H,9-10H2,1-3H3,(H,23,24,26)/t20-/m0/s1 |
| InChIKey | DKPIBVSTBGYWKN-FQEVSTJZSA-N |
| XLogP | 3.81 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|