C19H16FN3O4S — CID 92703245
[3-[(2S)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]phenyl] 2-fluorobenzoate (PubChem CID 92703245) has the molecular formula C19H16FN3O4S and a molecular weight of 401.42 g/mol. Its IUPAC name is [3-[(2S)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]phenyl] 2-fluorobenzoate.
| Compound Name | [3-[(2S)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 92703245 |
| Molecular Formula | C19H16FN3O4S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | [3-[(2S)-5-acetamido-3-acetyl-2H-1,3,4-thiadiazol-2-yl]phenyl] 2-fluorobenzoate |
| SMILES | CC(=O)NC1=NN(C(C)=O)[C@H](c2cccc(OC(=O)c3ccccc3F)c2)S1 |
| InChI | InChI=1S/C19H16FN3O4S/c1-11(24)21-19-22-23(12(2)25)17(28-19)13-6-5-7-14(10-13)27-18(26)15-8-3-4-9-16(15)20/h3-10,17H,1-2H3,(H,21,22,24)/t17-/m0/s1 |
| InChIKey | JEANLXMRLRVVJT-KRWDZBQOSA-N |
| XLogP | 3.05 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|