C23H32N6O4S — CID 162372206
3-[3-[[5-ethoxycarbonyl-2-(3-phenylpropylamino)pyrimidin-4-yl]amino]propylcarbamothioylamino]propanoic acid (PubChem CID 162372206) has the molecular formula C23H32N6O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is 3-[3-[[5-ethoxycarbonyl-2-(3-phenylpropylamino)pyrimidin-4-yl]amino]propylcarbamothioylamino]propanoic acid.
| Compound Name | 3-[3-[[5-ethoxycarbonyl-2-(3-phenylpropylamino)pyrimidin-4-yl]amino]propylcarbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 162372206 |
| Molecular Formula | C23H32N6O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 3-[3-[[5-ethoxycarbonyl-2-(3-phenylpropylamino)pyrimidin-4-yl]amino]propylcarbamothioylamino]propanoic acid |
| SMILES | CCOC(=O)c1cnc(NCCCc2ccccc2)nc1NCCCNC(=S)NCCC(=O)O |
| InChI | InChI=1S/C23H32N6O4S/c1-2-33-21(32)18-16-28-22(25-12-6-10-17-8-4-3-5-9-17)29-20(18)24-13-7-14-26-23(34)27-15-11-19(30)31/h3-5,8-9,16H,2,6-7,10-15H2,1H3,(H,30,31)(H2,26,27,34)(H2,24,25,28,29) |
| InChIKey | GLDUAZVLNPRMHM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|