C22H29N5O4S — CID 164613845
3-[3-[[5-ethoxycarbonyl-2-(2-phenylethyl)pyrimidin-4-yl]amino]propylcarbamothioylamino]propanoic acid (PubChem CID 164613845) has the molecular formula C22H29N5O4S and a molecular weight of 459.57 g/mol. Its IUPAC name is 3-[3-[[5-ethoxycarbonyl-2-(2-phenylethyl)pyrimidin-4-yl]amino]propylcarbamothioylamino]propanoic acid.
| Compound Name | 3-[3-[[5-ethoxycarbonyl-2-(2-phenylethyl)pyrimidin-4-yl]amino]propylcarbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 164613845 |
| Molecular Formula | C22H29N5O4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 3-[3-[[5-ethoxycarbonyl-2-(2-phenylethyl)pyrimidin-4-yl]amino]propylcarbamothioylamino]propanoic acid |
| SMILES | CCOC(=O)c1cnc(CCc2ccccc2)nc1NCCCNC(=S)NCCC(=O)O |
| InChI | InChI=1S/C22H29N5O4S/c1-2-31-21(30)17-15-26-18(10-9-16-7-4-3-5-8-16)27-20(17)23-12-6-13-24-22(32)25-14-11-19(28)29/h3-5,7-8,15H,2,6,9-14H2,1H3,(H,28,29)(H,23,26,27)(H2,24,25,32) |
| InChIKey | WHHZQMOJGPQGSK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|