C14H20N6O2 — CID 167984272
ethyl 2-ethyl-4-[2-(1-methyltriazol-4-yl)ethylamino]pyrimidine-5-carboxylate (PubChem CID 167984272) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is ethyl 2-ethyl-4-[2-(1-methyltriazol-4-yl)ethylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-ethyl-4-[2-(1-methyltriazol-4-yl)ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 167984272 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | ethyl 2-ethyl-4-[2-(1-methyltriazol-4-yl)ethylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CC)nc1NCCc1cn(C)nn1 |
| InChI | InChI=1S/C14H20N6O2/c1-4-12-16-8-11(14(21)22-5-2)13(17-12)15-7-6-10-9-20(3)19-18-10/h8-9H,4-7H2,1-3H3,(H,15,16,17) |
| InChIKey | VJQVJZPNCDBSRP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |