C16H16ClN3O4 — CID 90837125
(2S)-2-[(2-chloro-5-ethoxycarbonylpyrimidin-4-yl)amino]-3-phenylpropanoic acid (PubChem CID 90837125) has the molecular formula C16H16ClN3O4 and a molecular weight of 349.77 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-5-ethoxycarbonylpyrimidin-4-yl)amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(2-chloro-5-ethoxycarbonylpyrimidin-4-yl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 90837125 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | (2S)-2-[(2-chloro-5-ethoxycarbonylpyrimidin-4-yl)amino]-3-phenylpropanoic acid |
| SMILES | CCOC(=O)c1cnc(Cl)nc1N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H16ClN3O4/c1-2-24-15(23)11-9-18-16(17)20-13(11)19-12(14(21)22)8-10-6-4-3-5-7-10/h3-7,9,12H,2,8H2,1H3,(H,21,22)(H,18,19,20)/t12-/m0/s1 |
| InChIKey | LFKLWYGMAHCUEW-LBPRGKRZSA-N |
| XLogP | 2.41 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |