C13H18ClN3O2 — CID 135151263
ethyl 2-chloro-4-(cyclohexylamino)pyrimidine-5-carboxylate (PubChem CID 135151263) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is ethyl 2-chloro-4-(cyclohexylamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-chloro-4-(cyclohexylamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 135151263 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | ethyl 2-chloro-4-(cyclohexylamino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)nc1NC1CCCCC1 |
| InChI | InChI=1S/C13H18ClN3O2/c1-2-19-12(18)10-8-15-13(14)17-11(10)16-9-6-4-3-5-7-9/h8-9H,2-7H2,1H3,(H,15,16,17) |
| InChIKey | YDZDMKLOFHEDFQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |