C15H20ClN3O3 — CID 156776364
ethyl 2-chloro-4-[(3-hydroxy-8-bicyclo[3.2.1]octanyl)amino]pyrimidine-5-carboxylate (PubChem CID 156776364) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is ethyl 2-chloro-4-[(3-hydroxy-8-bicyclo[3.2.1]octanyl)amino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-chloro-4-[(3-hydroxy-8-bicyclo[3.2.1]octanyl)amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 156776364 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | ethyl 2-chloro-4-[(3-hydroxy-8-bicyclo[3.2.1]octanyl)amino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)nc1NC1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C15H20ClN3O3/c1-2-22-14(21)11-7-17-15(16)19-13(11)18-12-8-3-4-9(12)6-10(20)5-8/h7-10,12,20H,2-6H2,1H3,(H,17,18,19) |
| InChIKey | HEFFJIGSKHOZIM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |