C16H19ClN4O2 — CID 156572757
ethyl 2-chloro-4-[(4-cyano-1-bicyclo[2.2.2]octanyl)amino]pyrimidine-5-carboxylate (PubChem CID 156572757) has the molecular formula C16H19ClN4O2 and a molecular weight of 334.81 g/mol. Its IUPAC name is ethyl 2-chloro-4-[(4-cyano-1-bicyclo[2.2.2]octanyl)amino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-chloro-4-[(4-cyano-1-bicyclo[2.2.2]octanyl)amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 156572757 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | ethyl 2-chloro-4-[(4-cyano-1-bicyclo[2.2.2]octanyl)amino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)nc1NC12CCC(C#N)(CC1)CC2 |
| InChI | InChI=1S/C16H19ClN4O2/c1-2-23-13(22)11-9-19-14(17)20-12(11)21-16-6-3-15(10-18,4-7-16)5-8-16/h9H,2-8H2,1H3,(H,19,20,21) |
| InChIKey | FGBMYMGBNZXNKB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |