C14H18ClN3O3 — CID 156776383
ethyl 2-chloro-4-[(2-hydroxyspiro[3.3]heptan-6-yl)amino]pyrimidine-5-carboxylate (PubChem CID 156776383) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is ethyl 2-chloro-4-[(2-hydroxyspiro[3.3]heptan-6-yl)amino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-chloro-4-[(2-hydroxyspiro[3.3]heptan-6-yl)amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 156776383 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | ethyl 2-chloro-4-[(2-hydroxyspiro[3.3]heptan-6-yl)amino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)nc1NC1CC2(CC(O)C2)C1 |
| InChI | InChI=1S/C14H18ClN3O3/c1-2-21-12(20)10-7-16-13(15)18-11(10)17-8-3-14(4-8)5-9(19)6-14/h7-9,19H,2-6H2,1H3,(H,16,17,18) |
| InChIKey | ROMAOGTURDNFGJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |