About ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate
ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate (PubChem CID 71553238) has the molecular formula C18H20Cl2N4O3
and a molecular weight of 411.29 g/mol. Its IUPAC name is ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate |
| PubChem CID | 71553238 |
| Molecular Formula | C18H20Cl2N4O3 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2cc(Cl)cc(Cl)c2)nc1NC1CCOCC1 |
| InChI | InChI=1S/C18H20Cl2N4O3/c1-2-27-17(25)15-10-21-18(23-14-8-11(19)7-12(20)9-14)24-16(15)22-13-3-5-26-6-4-13/h7-10,13H,2-6H2,1H3,(H2,21,22,23,24) |
| InChIKey | YQBPWDBZJBBYGB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate?
The IUPAC name of ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate (CID 71553238) is ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate is CCOC(=O)c1cnc(Nc2cc(Cl)cc(Cl)c2)nc1NC1CCOCC1.
What is the InChIKey of ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate?
The InChIKey is YQBPWDBZJBBYGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20Cl2N4O3/c1-2-27-17(25)15-10-21-18(23-14-8-11(19)7-12(20)9-14)24-16(15)22-13-3-5-26-6-4-13/h7-10,13H,2-6H2,1H3,(H2,21,22,23,24).
What are the key properties of ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate?
ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate has a molecular weight of 411.29 g/mol, XLogP of 4.29, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3,5-dichloroanilino)-4-(oxan-4-ylamino)pyrimidine-5-carboxylate is sourced from PubChem (CID 71553238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).