C13H11Cl2N3O3 — CID 17229204
ethyl 2-(3,5-dichloroanilino)-6-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 17229204) has the molecular formula C13H11Cl2N3O3 and a molecular weight of 328.16 g/mol. Its IUPAC name is ethyl 2-(3,5-dichloroanilino)-6-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(3,5-dichloroanilino)-6-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 17229204 |
| Molecular Formula | C13H11Cl2N3O3 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | ethyl 2-(3,5-dichloroanilino)-6-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2cc(Cl)cc(Cl)c2)[nH]c1=O |
| InChI | InChI=1S/C13H11Cl2N3O3/c1-2-21-12(20)10-6-16-13(18-11(10)19)17-9-4-7(14)3-8(15)5-9/h3-6H,2H2,1H3,(H2,16,17,18,19) |
| InChIKey | GVGJXIFGJKZOFD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |