C9H11ClN2O2 — CID 20627001
ethyl 6-chloro-4-(methylamino)pyridine-3-carboxylate (PubChem CID 20627001) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is ethyl 6-chloro-4-(methylamino)pyridine-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-(methylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 20627001 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | ethyl 6-chloro-4-(methylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)cc1NC |
| InChI | InChI=1S/C9H11ClN2O2/c1-3-14-9(13)6-5-12-8(10)4-7(6)11-2/h4-5H,3H2,1-2H3,(H,11,12) |
| InChIKey | DEAFVBVKIMXSND-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|