C8H9ClN2O2 — CID 71512051
methyl 6-chloro-4-(methylamino)pyridine-3-carboxylate (PubChem CID 71512051) has the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. Its IUPAC name is methyl 6-chloro-4-(methylamino)pyridine-3-carboxylate.
| Compound Name | methyl 6-chloro-4-(methylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 71512051 |
| Molecular Formula | C8H9ClN2O2 |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | methyl 6-chloro-4-(methylamino)pyridine-3-carboxylate |
| SMILES | CNc1cc(Cl)ncc1C(=O)OC |
| InChI | InChI=1S/C8H9ClN2O2/c1-10-6-3-7(9)11-4-5(6)8(12)13-2/h3-4H,1-2H3,(H,10,11) |
| InChIKey | MCMCCUAPYAUWBV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|