C11H10ClN3O2S — CID 142587312
methyl 6-chloro-4-(1,3-thiazol-2-ylmethylamino)pyridine-3-carboxylate (PubChem CID 142587312) has the molecular formula C11H10ClN3O2S and a molecular weight of 283.74 g/mol. Its IUPAC name is methyl 6-chloro-4-(1,3-thiazol-2-ylmethylamino)pyridine-3-carboxylate.
| Compound Name | methyl 6-chloro-4-(1,3-thiazol-2-ylmethylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 142587312 |
| Molecular Formula | C11H10ClN3O2S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | methyl 6-chloro-4-(1,3-thiazol-2-ylmethylamino)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(Cl)cc1NCc1nccs1 |
| InChI | InChI=1S/C11H10ClN3O2S/c1-17-11(16)7-5-15-9(12)4-8(7)14-6-10-13-2-3-18-10/h2-5H,6H2,1H3,(H,14,15) |
| InChIKey | JFAYYFKDMBXHHT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|