C16H20Cl2N4O3 — CID 158099879
[6-chloro-4-(methylamino)-3-pyridinyl]methanol;ethyl 6-chloro-4-(methylamino)pyridine-3-carboxylate (PubChem CID 158099879) has the molecular formula C16H20Cl2N4O3 and a molecular weight of 387.27 g/mol. Its IUPAC name is [6-chloro-4-(methylamino)-3-pyridinyl]methanol;ethyl 6-chloro-4-(methylamino)pyridine-3-carboxylate.
| Compound Name | [6-chloro-4-(methylamino)-3-pyridinyl]methanol;ethyl 6-chloro-4-(methylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 158099879 |
| Molecular Formula | C16H20Cl2N4O3 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | [6-chloro-4-(methylamino)-3-pyridinyl]methanol;ethyl 6-chloro-4-(methylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)cc1NC.CNc1cc(Cl)ncc1CO |
| InChI | InChI=1S/C9H11ClN2O2.C7H9ClN2O/c1-3-14-9(13)6-5-12-8(10)4-7(6)11-2;1-9-6-2-7(8)10-3-5(6)4-11/h4-5H,3H2,1-2H3,(H,11,12);2-3,11H,4H2,1H3,(H,9,10) |
| InChIKey | FPCUVOUZXOJGAO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|