C13H16ClFN2O2 — CID 118206480
ethyl 6-chloro-4-[[(1S)-3-fluorocyclopentyl]amino]pyridine-3-carboxylate (PubChem CID 118206480) has the molecular formula C13H16ClFN2O2 and a molecular weight of 286.73 g/mol. Its IUPAC name is ethyl 6-chloro-4-[[(1S)-3-fluorocyclopentyl]amino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-[[(1S)-3-fluorocyclopentyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 118206480 |
| Molecular Formula | C13H16ClFN2O2 |
| Molecular Weight | 286.73 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | ethyl 6-chloro-4-[[(1S)-3-fluorocyclopentyl]amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)cc1N[C@H]1CCC(F)C1 |
| InChI | InChI=1S/C13H16ClFN2O2/c1-2-19-13(18)10-7-16-12(14)6-11(10)17-9-4-3-8(15)5-9/h6-9H,2-5H2,1H3,(H,16,17)/t8?,9-/m0/s1 |
| InChIKey | YAOOUQGXMNYFGG-GKAPJAKFSA-N |
| XLogP | 3.21 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.73 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|