C9H8ClNO4 — CID 163257477
6-chloro-4-ethoxycarbonylpyridine-3-carboxylic acid (PubChem CID 163257477) has the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. Its IUPAC name is 6-chloro-4-ethoxycarbonylpyridine-3-carboxylic acid.
| Compound Name | 6-chloro-4-ethoxycarbonylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 163257477 |
| Molecular Formula | C9H8ClNO4 |
| Molecular Weight | 229.62 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 6-chloro-4-ethoxycarbonylpyridine-3-carboxylic acid |
| SMILES | CCOC(=O)c1cc(Cl)ncc1C(=O)O |
| InChI | InChI=1S/C9H8ClNO4/c1-2-15-9(14)5-3-7(10)11-4-6(5)8(12)13/h3-4H,2H2,1H3,(H,12,13) |
| InChIKey | XNYRUSUETQVJJM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.62 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|