C15H20ClN3O5 — CID 167022503
ethyl 2-chloro-5-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]pyridine-4-carboxylate (PubChem CID 167022503) has the molecular formula C15H20ClN3O5 and a molecular weight of 357.79 g/mol. Its IUPAC name is ethyl 2-chloro-5-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]pyridine-4-carboxylate.
| Compound Name | ethyl 2-chloro-5-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 167022503 |
| Molecular Formula | C15H20ClN3O5 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | ethyl 2-chloro-5-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(Cl)ncc1C(=O)N(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20ClN3O5/c1-6-23-13(21)9-7-11(16)17-8-10(9)12(20)19(5)18-14(22)24-15(2,3)4/h7-8H,6H2,1-5H3,(H,18,22) |
| InChIKey | PCNQZRBIGTVJPG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|