C20H24Cl2N4O4 — CID 22142847
ethyl 4-(2,4-dichlorophenyl)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidine-5-carboxylate (PubChem CID 22142847) has the molecular formula C20H24Cl2N4O4 and a molecular weight of 455.34 g/mol. Its IUPAC name is ethyl 4-(2,4-dichlorophenyl)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(2,4-dichlorophenyl)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 22142847 |
| Molecular Formula | C20H24Cl2N4O4 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | ethyl 4-(2,4-dichlorophenyl)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCNC(=O)OC(C)(C)C)nc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H24Cl2N4O4/c1-5-29-17(27)14-11-25-18(23-8-9-24-19(28)30-20(2,3)4)26-16(14)13-7-6-12(21)10-15(13)22/h6-7,10-11H,5,8-9H2,1-4H3,(H,24,28)(H,23,25,26) |
| InChIKey | QTXRVEAVTLZGCX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|