C10H8ClF3N2O3 — CID 86657942
ethyl 6-chloro-4-[(2,2,2-trifluoroacetyl)amino]pyridine-3-carboxylate (PubChem CID 86657942) has the molecular formula C10H8ClF3N2O3 and a molecular weight of 296.63 g/mol. Its IUPAC name is ethyl 6-chloro-4-[(2,2,2-trifluoroacetyl)amino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-[(2,2,2-trifluoroacetyl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 86657942 |
| Molecular Formula | C10H8ClF3N2O3 |
| Molecular Weight | 296.63 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | ethyl 6-chloro-4-[(2,2,2-trifluoroacetyl)amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)cc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H8ClF3N2O3/c1-2-19-8(17)5-4-15-7(11)3-6(5)16-9(18)10(12,13)14/h3-4H,2H2,1H3,(H,15,16,18) |
| InChIKey | FDEYATFZAYNLNU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.63 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|