C11H8Cl2F3NO3 — CID 2797906
ethyl 3,5-dichloro-4-[(2,2,2-trifluoroacetyl)amino]benzoate (PubChem CID 2797906) has the molecular formula C11H8Cl2F3NO3 and a molecular weight of 330.09 g/mol. Its IUPAC name is ethyl 3,5-dichloro-4-[(2,2,2-trifluoroacetyl)amino]benzoate.
| Compound Name | ethyl 3,5-dichloro-4-[(2,2,2-trifluoroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 2797906 |
| Molecular Formula | C11H8Cl2F3NO3 |
| Molecular Weight | 330.09 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | ethyl 3,5-dichloro-4-[(2,2,2-trifluoroacetyl)amino]benzoate |
| SMILES | CCOC(=O)c1cc(Cl)c(NC(=O)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H8Cl2F3NO3/c1-2-20-9(18)5-3-6(12)8(7(13)4-5)17-10(19)11(14,15)16/h3-4H,2H2,1H3,(H,17,19) |
| InChIKey | YSMIIHWFZPAJTF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.09 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |