C11H9BrF3NO3 — CID 10065821
ethyl 5-bromo-2-[(2,2,2-trifluoroacetyl)amino]benzoate (PubChem CID 10065821) has the molecular formula C11H9BrF3NO3 and a molecular weight of 340.10 g/mol. Its IUPAC name is ethyl 5-bromo-2-[(2,2,2-trifluoroacetyl)amino]benzoate.
| Compound Name | ethyl 5-bromo-2-[(2,2,2-trifluoroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 10065821 |
| Molecular Formula | C11H9BrF3NO3 |
| Molecular Weight | 340.10 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | ethyl 5-bromo-2-[(2,2,2-trifluoroacetyl)amino]benzoate |
| SMILES | CCOC(=O)c1cc(Br)ccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H9BrF3NO3/c1-2-19-9(17)7-5-6(12)3-4-8(7)16-10(18)11(13,14)15/h3-5H,2H2,1H3,(H,16,18) |
| InChIKey | HPPKBQJCGRODMH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.10 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |