C16H16BrNO6 — CID 166118947
ethyl 5-bromo-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate (PubChem CID 166118947) has the molecular formula C16H16BrNO6 and a molecular weight of 398.21 g/mol. Its IUPAC name is ethyl 5-bromo-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate.
| Compound Name | ethyl 5-bromo-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate |
|---|---|
| PubChem CID | 166118947 |
| Molecular Formula | C16H16BrNO6 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | ethyl 5-bromo-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate |
| SMILES | CCOC(=O)c1cc(Br)ccc1NC=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C16H16BrNO6/c1-4-22-13(19)10-7-9(17)5-6-12(10)18-8-11-14(20)23-16(2,3)24-15(11)21/h5-8,18H,4H2,1-3H3 |
| InChIKey | ZURICHLMBMIWHA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|