C15H12F3NO7 — CID 168536856
2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-(trifluoromethoxy)benzoic acid (PubChem CID 168536856) has the molecular formula C15H12F3NO7 and a molecular weight of 375.26 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-(trifluoromethoxy)benzoic acid.
| Compound Name | 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 168536856 |
| Molecular Formula | C15H12F3NO7 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-(trifluoromethoxy)benzoic acid |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc(OC(F)(F)F)cc2C(=O)O)C(=O)O1 |
| InChI | InChI=1S/C15H12F3NO7/c1-14(2)25-12(22)9(13(23)26-14)6-19-10-4-3-7(24-15(16,17)18)5-8(10)11(20)21/h3-6,19H,1-2H3,(H,20,21) |
| InChIKey | FGFSDGLDQRCRCC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|