C17H17F4NO5 — CID 168540067
2,2-dimethyl-5-[[2-methyl-4-(2,2,3,3-tetrafluoropropoxy)anilino]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168540067) has the molecular formula C17H17F4NO5 and a molecular weight of 391.32 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[2-methyl-4-(2,2,3,3-tetrafluoropropoxy)anilino]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[2-methyl-4-(2,2,3,3-tetrafluoropropoxy)anilino]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168540067 |
| Molecular Formula | C17H17F4NO5 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2,2-dimethyl-5-[[2-methyl-4-(2,2,3,3-tetrafluoropropoxy)anilino]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | Cc1cc(OCC(F)(F)C(F)F)ccc1NC=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C17H17F4NO5/c1-9-6-10(25-8-17(20,21)15(18)19)4-5-12(9)22-7-11-13(23)26-16(2,3)27-14(11)24/h4-7,15,22H,8H2,1-3H3 |
| InChIKey | SHCRXGOMJRNARL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|