C13H17F4NO3 — CID 168594810
3-[2-methyl-4-(2,2,3,3-tetrafluoropropoxy)anilino]propane-1,2-diol (PubChem CID 168594810) has the molecular formula C13H17F4NO3 and a molecular weight of 311.28 g/mol. Its IUPAC name is 3-[2-methyl-4-(2,2,3,3-tetrafluoropropoxy)anilino]propane-1,2-diol.
| Compound Name | 3-[2-methyl-4-(2,2,3,3-tetrafluoropropoxy)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168594810 |
| Molecular Formula | C13H17F4NO3 |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-[2-methyl-4-(2,2,3,3-tetrafluoropropoxy)anilino]propane-1,2-diol |
| SMILES | Cc1cc(OCC(F)(F)C(F)F)ccc1NCC(O)CO |
| InChI | InChI=1S/C13H17F4NO3/c1-8-4-10(21-7-13(16,17)12(14)15)2-3-11(8)18-5-9(20)6-19/h2-4,9,12,18-20H,5-7H2,1H3 |
| InChIKey | ILDOPADHLTYCJE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|