C12H16F3NO3 — CID 168595342
3-[2-methyl-4-(2,2,2-trifluoroethoxy)anilino]propane-1,2-diol (PubChem CID 168595342) has the molecular formula C12H16F3NO3 and a molecular weight of 279.26 g/mol. Its IUPAC name is 3-[2-methyl-4-(2,2,2-trifluoroethoxy)anilino]propane-1,2-diol.
| Compound Name | 3-[2-methyl-4-(2,2,2-trifluoroethoxy)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168595342 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 3-[2-methyl-4-(2,2,2-trifluoroethoxy)anilino]propane-1,2-diol |
| SMILES | Cc1cc(OCC(F)(F)F)ccc1NCC(O)CO |
| InChI | InChI=1S/C12H16F3NO3/c1-8-4-10(19-7-12(13,14)15)2-3-11(8)16-5-9(18)6-17/h2-4,9,16-18H,5-7H2,1H3 |
| InChIKey | VAAYMROPKGZGKM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|