C11H14F3NO2 — CID 168593240
3-[5-methyl-2-(trifluoromethyl)anilino]propane-1,2-diol (PubChem CID 168593240) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 3-[5-methyl-2-(trifluoromethyl)anilino]propane-1,2-diol.
| Compound Name | 3-[5-methyl-2-(trifluoromethyl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168593240 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-[5-methyl-2-(trifluoromethyl)anilino]propane-1,2-diol |
| SMILES | Cc1ccc(C(F)(F)F)c(NCC(O)CO)c1 |
| InChI | InChI=1S/C11H14F3NO2/c1-7-2-3-9(11(12,13)14)10(4-7)15-5-8(17)6-16/h2-4,8,15-17H,5-6H2,1H3 |
| InChIKey | VHAZCAZVYCVKHB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |